C23H25ClN2O7S — CID 66769773
2-chloro-N-[[2-[2-(3-ethoxy-4-methoxyphenyl)-2-methylsulfonylethyl]-1,3-dioxoisoindol-4-yl]methyl]acetamide (PubChem CID 66769773) has the molecular formula C23H25ClN2O7S and a molecular weight of 508.98 g/mol. Its IUPAC name is 2-chloro-N-[[2-[2-(3-ethoxy-4-methoxyphenyl)-2-methylsulfonylethyl]-1,3-dioxoisoindol-4-yl]methyl]acetamide.
| Compound Name | 2-chloro-N-[[2-[2-(3-ethoxy-4-methoxyphenyl)-2-methylsulfonylethyl]-1,3-dioxoisoindol-4-yl]methyl]acetamide |
|---|---|
| PubChem CID | 66769773 |
| Molecular Formula | C23H25ClN2O7S |
| Molecular Weight | 508.98 g/mol |
| Exact Mass | 508.11 |
| IUPAC Name | 2-chloro-N-[[2-[2-(3-ethoxy-4-methoxyphenyl)-2-methylsulfonylethyl]-1,3-dioxoisoindol-4-yl]methyl]acetamide |
| SMILES | CCOc1cc(C(CN2C(=O)c3cccc(CNC(=O)CCl)c3C2=O)S(C)(=O)=O)ccc1OC |
| InChI | InChI=1S/C23H25ClN2O7S/c1-4-33-18-10-14(8-9-17(18)32-2)19(34(3,30)31)13-26-22(28)16-7-5-6-15(21(16)23(26)29)12-25-20(27)11-24/h5-10,19H,4,11-13H2,1-3H3,(H,25,27) |
| InChIKey | KNXJMNNJODFAMM-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.98 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|