C20H20N2O8S2 — CID 67213523
(2S)-2-(1,3-dioxoisoindol-2-yl)-3-methyl-4-[(2-methylsulfonylphenyl)sulfonylamino]butanoic acid (PubChem CID 67213523) has the molecular formula C20H20N2O8S2 and a molecular weight of 480.52 g/mol. Its IUPAC name is (2S)-2-(1,3-dioxoisoindol-2-yl)-3-methyl-4-[(2-methylsulfonylphenyl)sulfonylamino]butanoic acid.
| Compound Name | (2S)-2-(1,3-dioxoisoindol-2-yl)-3-methyl-4-[(2-methylsulfonylphenyl)sulfonylamino]butanoic acid |
|---|---|
| PubChem CID | 67213523 |
| Molecular Formula | C20H20N2O8S2 |
| Molecular Weight | 480.52 g/mol |
| Exact Mass | 480.07 |
| IUPAC Name | (2S)-2-(1,3-dioxoisoindol-2-yl)-3-methyl-4-[(2-methylsulfonylphenyl)sulfonylamino]butanoic acid |
| SMILES | CC(CNS(=O)(=O)c1ccccc1S(C)(=O)=O)[C@@H](C(=O)O)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C20H20N2O8S2/c1-12(11-21-32(29,30)16-10-6-5-9-15(16)31(2,27)28)17(20(25)26)22-18(23)13-7-3-4-8-14(13)19(22)24/h3-10,12,17,21H,11H2,1-2H3,(H,25,26)/t12?,17-/m0/s1 |
| InChIKey | BJDKPAJGYKFYEH-TYJDENFWSA-N |
| XLogP | 0.75 |
| TPSA | 154.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.52 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|