C20H19Br2N5O6 — CID 68611761
4-amino-3,5-dibromobenzoic acid;4-amino-2-hydroxybenzoic acid;pyridine-4-carbohydrazide (PubChem CID 68611761) has the molecular formula C20H19Br2N5O6 and a molecular weight of 585.21 g/mol. Its IUPAC name is 4-amino-3,5-dibromobenzoic acid;4-amino-2-hydroxybenzoic acid;pyridine-4-carbohydrazide.
| Compound Name | 4-amino-3,5-dibromobenzoic acid;4-amino-2-hydroxybenzoic acid;pyridine-4-carbohydrazide |
|---|---|
| PubChem CID | 68611761 |
| Molecular Formula | C20H19Br2N5O6 |
| Molecular Weight | 585.21 g/mol |
| Exact Mass | 582.97 |
| IUPAC Name | 4-amino-3,5-dibromobenzoic acid;4-amino-2-hydroxybenzoic acid;pyridine-4-carbohydrazide |
| SMILES | NNC(=O)c1ccncc1.Nc1c(Br)cc(C(=O)O)cc1Br.Nc1ccc(C(=O)O)c(O)c1 |
| InChI | InChI=1S/C7H5Br2NO2.C7H7NO3.C6H7N3O/c8-4-1-3(7(11)12)2-5(9)6(4)10;8-4-1-2-5(7(10)11)6(9)3-4;7-9-6(10)5-1-3-8-4-2-5/h1-2H,10H2,(H,11,12);1-3,9H,8H2,(H,10,11);1-4H,7H2,(H,9,10) |
| InChIKey | PZZSUNOWLYPWFD-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 214.88 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.21 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|