C11H14IN3O4 — CID 68910372
[3-(2,5-dioxoimidazolidin-4-yl)-3-iodoprop-1-ynyl] N-butylcarbamate (PubChem CID 68910372) has the molecular formula C11H14IN3O4 and a molecular weight of 379.15 g/mol. Its IUPAC name is [3-(2,5-dioxoimidazolidin-4-yl)-3-iodoprop-1-ynyl] N-butylcarbamate.
| Compound Name | [3-(2,5-dioxoimidazolidin-4-yl)-3-iodoprop-1-ynyl] N-butylcarbamate |
|---|---|
| PubChem CID | 68910372 |
| Molecular Formula | C11H14IN3O4 |
| Molecular Weight | 379.15 g/mol |
| Exact Mass | 379.00 |
| IUPAC Name | [3-(2,5-dioxoimidazolidin-4-yl)-3-iodoprop-1-ynyl] N-butylcarbamate |
| SMILES | CCCCNC(=O)OC#CC(I)C1NC(=O)NC1=O |
| InChI | InChI=1S/C11H14IN3O4/c1-2-3-5-13-11(18)19-6-4-7(12)8-9(16)15-10(17)14-8/h7-8H,2-3,5H2,1H3,(H,13,18)(H2,14,15,16,17) |
| InChIKey | ZSUYICHMCAEHOY-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.15 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|