C26H23N3O4PS+ — CID 69041792
[3-amino-1-[4-[(2-amino-5-thiophen-2-ylphenyl)carbamoyl]phenyl]-3-oxopropoxy]-oxo-phenylphosphanium (PubChem CID 69041792) has the molecular formula C26H23N3O4PS+ and a molecular weight of 504.53 g/mol. Its IUPAC name is [3-amino-1-[4-[(2-amino-5-thiophen-2-ylphenyl)carbamoyl]phenyl]-3-oxopropoxy]-oxo-phenylphosphanium.
| Compound Name | [3-amino-1-[4-[(2-amino-5-thiophen-2-ylphenyl)carbamoyl]phenyl]-3-oxopropoxy]-oxo-phenylphosphanium |
|---|---|
| PubChem CID | 69041792 |
| Molecular Formula | C26H23N3O4PS+ |
| Molecular Weight | 504.53 g/mol |
| Exact Mass | 504.11 |
| IUPAC Name | [3-amino-1-[4-[(2-amino-5-thiophen-2-ylphenyl)carbamoyl]phenyl]-3-oxopropoxy]-oxo-phenylphosphanium |
| SMILES | NC(=O)CC(O[P+](=O)c1ccccc1)c1ccc(C(=O)Nc2cc(-c3cccs3)ccc2N)cc1 |
| InChI | InChI=1S/C26H22N3O4PS/c27-21-13-12-19(24-7-4-14-35-24)15-22(21)29-26(31)18-10-8-17(9-11-18)23(16-25(28)30)33-34(32)20-5-2-1-3-6-20/h1-15,23H,16,27H2,(H2-,28,29,30,31)/p+1 |
| InChIKey | UMYUCFHVEBKHIV-UHFFFAOYSA-O |
| XLogP | 5.25 |
| TPSA | 124.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.53 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|