C24H26Cl2FN3O2 — CID 69146423
3-chloro-N-[3-[5-(4-chloro-2-fluorobenzoyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]propyl]-4-methylbenzamide (PubChem CID 69146423) has the molecular formula C24H26Cl2FN3O2 and a molecular weight of 478.40 g/mol. Its IUPAC name is 3-chloro-N-[3-[5-(4-chloro-2-fluorobenzoyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]propyl]-4-methylbenzamide.
| Compound Name | 3-chloro-N-[3-[5-(4-chloro-2-fluorobenzoyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]propyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 69146423 |
| Molecular Formula | C24H26Cl2FN3O2 |
| Molecular Weight | 478.40 g/mol |
| Exact Mass | 477.14 |
| IUPAC Name | 3-chloro-N-[3-[5-(4-chloro-2-fluorobenzoyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]propyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NCCCN2CC3CN(C(=O)c4ccc(Cl)cc4F)CC3C2)cc1Cl |
| InChI | InChI=1S/C24H26Cl2FN3O2/c1-15-3-4-16(9-21(15)26)23(31)28-7-2-8-29-11-17-13-30(14-18(17)12-29)24(32)20-6-5-19(25)10-22(20)27/h3-6,9-10,17-18H,2,7-8,11-14H2,1H3,(H,28,31) |
| InChIKey | OSZXCAGKAAKLGA-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.40 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|