C36H46N4O5S2 — CID 69420727
N-[(2S,4S,5S)-5-[[2-[2,6-bis(methylsulfanyl)phenoxy]acetyl]amino]-4-hydroxy-1,6-diphenylhexan-2-yl]-3-methyl-4-(2-oxoimidazolidin-1-yl)butanamide (PubChem CID 69420727) has the molecular formula C36H46N4O5S2 and a molecular weight of 678.92 g/mol. Its IUPAC name is N-[(2S,4S,5S)-5-[[2-[2,6-bis(methylsulfanyl)phenoxy]acetyl]amino]-4-hydroxy-1,6-diphenylhexan-2-yl]-3-methyl-4-(2-oxoimidazolidin-1-yl)butanamide.
| Compound Name | N-[(2S,4S,5S)-5-[[2-[2,6-bis(methylsulfanyl)phenoxy]acetyl]amino]-4-hydroxy-1,6-diphenylhexan-2-yl]-3-methyl-4-(2-oxoimidazolidin-1-yl)butanamide |
|---|---|
| PubChem CID | 69420727 |
| Molecular Formula | C36H46N4O5S2 |
| Molecular Weight | 678.92 g/mol |
| Exact Mass | 678.29 |
| IUPAC Name | N-[(2S,4S,5S)-5-[[2-[2,6-bis(methylsulfanyl)phenoxy]acetyl]amino]-4-hydroxy-1,6-diphenylhexan-2-yl]-3-methyl-4-(2-oxoimidazolidin-1-yl)butanamide |
| SMILES | CSc1cccc(SC)c1OCC(=O)N[C@@H](Cc1ccccc1)[C@@H](O)C[C@H](Cc1ccccc1)NC(=O)CC(C)CN1CCNC1=O |
| InChI | InChI=1S/C36H46N4O5S2/c1-25(23-40-18-17-37-36(40)44)19-33(42)38-28(20-26-11-6-4-7-12-26)22-30(41)29(21-27-13-8-5-9-14-27)39-34(43)24-45-35-31(46-2)15-10-16-32(35)47-3/h4-16,25,28-30,41H,17-24H2,1-3H3,(H,37,44)(H,38,42)(H,39,43)/t25?,28-,29-,30-/m0/s1 |
| InChIKey | LAHHMBMBWMDXMM-ASHGWBGTSA-N |
| XLogP | 4.77 |
| TPSA | 120.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.92 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |