C16H25N5O6 — CID 69434609
(2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;(2S)-2-[3-(furan-2-yl)prop-2-enoylamino]propanoic acid (PubChem CID 69434609) has the molecular formula C16H25N5O6 and a molecular weight of 383.41 g/mol. Its IUPAC name is (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;(2S)-2-[3-(furan-2-yl)prop-2-enoylamino]propanoic acid.
| Compound Name | (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;(2S)-2-[3-(furan-2-yl)prop-2-enoylamino]propanoic acid |
|---|---|
| PubChem CID | 69434609 |
| Molecular Formula | C16H25N5O6 |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;(2S)-2-[3-(furan-2-yl)prop-2-enoylamino]propanoic acid |
| SMILES | C[C@H](NC(=O)C=Cc1ccco1)C(=O)O.NC(N)=NCCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C10H11NO4.C6H14N4O2/c1-7(10(13)14)11-9(12)5-4-8-3-2-6-15-8;7-4(5(11)12)2-1-3-10-6(8)9/h2-7H,1H3,(H,11,12)(H,13,14);4H,1-3,7H2,(H,11,12)(H4,8,9,10)/t7-;4-/m00/s1 |
| InChIKey | XZYATVASJSHVCR-JXJGXUGVSA-N |
| XLogP | -0.67 |
| TPSA | 207.26 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|