C14H14Cl3N3O — CID 70137154
1-phenylethanone;2,4,6-tris(chloromethyl)-1,3,5-triazine (PubChem CID 70137154) has the molecular formula C14H14Cl3N3O and a molecular weight of 346.65 g/mol. Its IUPAC name is 1-phenylethanone;2,4,6-tris(chloromethyl)-1,3,5-triazine.
| Compound Name | 1-phenylethanone;2,4,6-tris(chloromethyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 70137154 |
| Molecular Formula | C14H14Cl3N3O |
| Molecular Weight | 346.65 g/mol |
| Exact Mass | 345.02 |
| IUPAC Name | 1-phenylethanone;2,4,6-tris(chloromethyl)-1,3,5-triazine |
| SMILES | CC(=O)c1ccccc1.ClCc1nc(CCl)nc(CCl)n1 |
| InChI | InChI=1S/C8H8O.C6H6Cl3N3/c1-7(9)8-5-3-2-4-6-8;7-1-4-10-5(2-8)12-6(3-9)11-4/h2-6H,1H3;1-3H2 |
| InChIKey | BNTASKGLECOSCX-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 55.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.65 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|