About 6-methyl-3-oxa-1,5-diazabicyclo[3.1.0]hexane
6-methyl-3-oxa-1,5-diazabicyclo[3.1.0]hexane (PubChem CID 70425904) has the molecular formula C4H8N2O
and a molecular weight of 100.12 g/mol. Its IUPAC name is 6-methyl-3-oxa-1,5-diazabicyclo[3.1.0]hexane.
Molecular Properties
| Compound Name | 6-methyl-3-oxa-1,5-diazabicyclo[3.1.0]hexane |
| PubChem CID | 70425904 |
| Molecular Formula | C4H8N2O |
| Molecular Weight | 100.12 g/mol |
| Exact Mass | 100.06 |
| IUPAC Name | 6-methyl-3-oxa-1,5-diazabicyclo[3.1.0]hexane |
| SMILES | CC1N2COCN12 |
| InChI | InChI=1S/C4H8N2O/c1-4-5-2-7-3-6(4)5/h4H,2-3H2,1H3 |
| InChIKey | HJRFIYAKRHZMRL-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 15.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 100.12 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 6-methyl-3-oxa-1,5-diazabicyclo[3.1.0]hexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-3-oxa-1,5-diazabicyclo[3.1.0]hexane?
The IUPAC name of 6-methyl-3-oxa-1,5-diazabicyclo[3.1.0]hexane (CID 70425904) is 6-methyl-3-oxa-1,5-diazabicyclo[3.1.0]hexane.
What is the SMILES notation for 6-methyl-3-oxa-1,5-diazabicyclo[3.1.0]hexane?
The canonical SMILES for 6-methyl-3-oxa-1,5-diazabicyclo[3.1.0]hexane is CC1N2COCN12.
What is the InChIKey of 6-methyl-3-oxa-1,5-diazabicyclo[3.1.0]hexane?
The InChIKey is HJRFIYAKRHZMRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8N2O/c1-4-5-2-7-3-6(4)5/h4H,2-3H2,1H3.
What are the key properties of 6-methyl-3-oxa-1,5-diazabicyclo[3.1.0]hexane?
6-methyl-3-oxa-1,5-diazabicyclo[3.1.0]hexane has a molecular weight of 100.12 g/mol, XLogP of -0.19, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-3-oxa-1,5-diazabicyclo[3.1.0]hexane is sourced from PubChem (CID 70425904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).