C25H21N2O4+ — CID 70548613
1-[(2,3-dihydroxyphenyl)-(4-hydroxyphenyl)-phenylmethyl]pyridin-1-ium-4-carboxamide (PubChem CID 70548613) has the molecular formula C25H21N2O4+ and a molecular weight of 413.45 g/mol. Its IUPAC name is 1-[(2,3-dihydroxyphenyl)-(4-hydroxyphenyl)-phenylmethyl]pyridin-1-ium-4-carboxamide.
| Compound Name | 1-[(2,3-dihydroxyphenyl)-(4-hydroxyphenyl)-phenylmethyl]pyridin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 70548613 |
| Molecular Formula | C25H21N2O4+ |
| Molecular Weight | 413.45 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | 1-[(2,3-dihydroxyphenyl)-(4-hydroxyphenyl)-phenylmethyl]pyridin-1-ium-4-carboxamide |
| SMILES | NC(=O)c1cc[n+](C(c2ccccc2)(c2ccc(O)cc2)c2cccc(O)c2O)cc1 |
| InChI | InChI=1S/C25H20N2O4/c26-24(31)17-13-15-27(16-14-17)25(18-5-2-1-3-6-18,19-9-11-20(28)12-10-19)21-7-4-8-22(29)23(21)30/h1-16,28,31H,26H2/p+1 |
| InChIKey | DTGFKHOXMIROKA-UHFFFAOYSA-O |
| XLogP | 3.03 |
| TPSA | 107.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.45 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|