C16H13Cl2NO4 — CID 70623114
(3,4-dichlorophenyl)-[2-(1,3-dioxolan-2-yl)phenyl]carbamic acid (PubChem CID 70623114) has the molecular formula C16H13Cl2NO4 and a molecular weight of 354.19 g/mol. Its IUPAC name is (3,4-dichlorophenyl)-[2-(1,3-dioxolan-2-yl)phenyl]carbamic acid.
| Compound Name | (3,4-dichlorophenyl)-[2-(1,3-dioxolan-2-yl)phenyl]carbamic acid |
|---|---|
| PubChem CID | 70623114 |
| Molecular Formula | C16H13Cl2NO4 |
| Molecular Weight | 354.19 g/mol |
| Exact Mass | 353.02 |
| IUPAC Name | (3,4-dichlorophenyl)-[2-(1,3-dioxolan-2-yl)phenyl]carbamic acid |
| SMILES | O=C(O)N(c1ccc(Cl)c(Cl)c1)c1ccccc1C1OCCO1 |
| InChI | InChI=1S/C16H13Cl2NO4/c17-12-6-5-10(9-13(12)18)19(16(20)21)14-4-2-1-3-11(14)15-22-7-8-23-15/h1-6,9,15H,7-8H2,(H,20,21) |
| InChIKey | IYFLOWRXLGJPNQ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.19 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |