C8H16N2O+2 — CID 7063233
[(1R)-2-azaniumyl-1-(furan-2-yl)ethyl]-dimethylazanium (PubChem CID 7063233) has the molecular formula C8H16N2O+2 and a molecular weight of 156.23 g/mol. Its IUPAC name is [(1R)-2-azaniumyl-1-(furan-2-yl)ethyl]-dimethylazanium.
| Compound Name | [(1R)-2-azaniumyl-1-(furan-2-yl)ethyl]-dimethylazanium |
|---|---|
| PubChem CID | 7063233 |
| Molecular Formula | C8H16N2O+2 |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.13 |
| IUPAC Name | [(1R)-2-azaniumyl-1-(furan-2-yl)ethyl]-dimethylazanium |
| SMILES | C[NH+](C)[C@H](C[NH3+])c1ccco1 |
| InChI | InChI=1S/C8H14N2O/c1-10(2)7(6-9)8-4-3-5-11-8/h3-5,7H,6,9H2,1-2H3/p+2/t7-/m1/s1 |
| InChIKey | AZJFCUDCKGDHOQ-SSDOTTSWSA-P |
| XLogP | -1.29 |
| TPSA | 45.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |