C20H32N2O4Si — CID 70810165
2-[4,5-dimethoxy-2-[2-methyl-1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]phenyl]ethanol (PubChem CID 70810165) has the molecular formula C20H32N2O4Si and a molecular weight of 392.57 g/mol. Its IUPAC name is 2-[4,5-dimethoxy-2-[2-methyl-1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]phenyl]ethanol.
| Compound Name | 2-[4,5-dimethoxy-2-[2-methyl-1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]phenyl]ethanol |
|---|---|
| PubChem CID | 70810165 |
| Molecular Formula | C20H32N2O4Si |
| Molecular Weight | 392.57 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | 2-[4,5-dimethoxy-2-[2-methyl-1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]phenyl]ethanol |
| SMILES | COc1cc(CCO)c(-c2cn(COCC[Si](C)(C)C)c(C)n2)cc1OC |
| InChI | InChI=1S/C20H32N2O4Si/c1-15-21-18(13-22(15)14-26-9-10-27(4,5)6)17-12-20(25-3)19(24-2)11-16(17)7-8-23/h11-13,23H,7-10,14H2,1-6H3 |
| InChIKey | LVDOZFQAWVZMLB-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 65.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.57 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|