C20H25F2N7O4 — CID 70891486
(5S)-5-(aminomethyl)-3-[3,5-difluoro-4-[1-[2-(1,2-oxazol-4-ylmethylamino)acetyl]-1,2,5-triazepan-5-yl]phenyl]-1,3-oxazolidin-2-one (PubChem CID 70891486) has the molecular formula C20H25F2N7O4 and a molecular weight of 465.46 g/mol. Its IUPAC name is (5S)-5-(aminomethyl)-3-[3,5-difluoro-4-[1-[2-(1,2-oxazol-4-ylmethylamino)acetyl]-1,2,5-triazepan-5-yl]phenyl]-1,3-oxazolidin-2-one.
| Compound Name | (5S)-5-(aminomethyl)-3-[3,5-difluoro-4-[1-[2-(1,2-oxazol-4-ylmethylamino)acetyl]-1,2,5-triazepan-5-yl]phenyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 70891486 |
| Molecular Formula | C20H25F2N7O4 |
| Molecular Weight | 465.46 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | (5S)-5-(aminomethyl)-3-[3,5-difluoro-4-[1-[2-(1,2-oxazol-4-ylmethylamino)acetyl]-1,2,5-triazepan-5-yl]phenyl]-1,3-oxazolidin-2-one |
| SMILES | NC[C@H]1CN(c2cc(F)c(N3CCNN(C(=O)CNCc4cnoc4)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C20H25F2N7O4/c21-16-5-14(28-11-15(7-23)33-20(28)31)6-17(22)19(16)27-2-1-25-29(4-3-27)18(30)10-24-8-13-9-26-32-12-13/h5-6,9,12,15,24-25H,1-4,7-8,10-11,23H2/t15-/m0/s1 |
| InChIKey | NPSNLVSRBNWBSU-HNNXBMFYSA-N |
| XLogP | 0.18 |
| TPSA | 129.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.46 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|