C11H24NO5+ — CID 70920657
6-(1-methylpyrrolidin-1-ium-1-yl)hexane-1,2,3,4,5-pentol (PubChem CID 70920657) has the molecular formula C11H24NO5+ and a molecular weight of 250.31 g/mol. Its IUPAC name is 6-(1-methylpyrrolidin-1-ium-1-yl)hexane-1,2,3,4,5-pentol.
| Compound Name | 6-(1-methylpyrrolidin-1-ium-1-yl)hexane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 70920657 |
| Molecular Formula | C11H24NO5+ |
| Molecular Weight | 250.31 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | 6-(1-methylpyrrolidin-1-ium-1-yl)hexane-1,2,3,4,5-pentol |
| SMILES | C[N+]1(CC(O)C(O)C(O)C(O)CO)CCCC1 |
| InChI | InChI=1S/C11H24NO5/c1-12(4-2-3-5-12)6-8(14)10(16)11(17)9(15)7-13/h8-11,13-17H,2-7H2,1H3/q+1 |
| InChIKey | YDZKJWFDAXIIQG-UHFFFAOYSA-N |
| XLogP | -2.34 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.31 |
| LogP ≤ 5 | -2.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|