C10H16N2O4SSi — CID 71381685
4-methyl-N-nitro-N-trimethylsilylbenzenesulfonamide (PubChem CID 71381685) has the molecular formula C10H16N2O4SSi and a molecular weight of 288.40 g/mol. Its IUPAC name is 4-methyl-N-nitro-N-trimethylsilylbenzenesulfonamide.
| Compound Name | 4-methyl-N-nitro-N-trimethylsilylbenzenesulfonamide |
|---|---|
| PubChem CID | 71381685 |
| Molecular Formula | C10H16N2O4SSi |
| Molecular Weight | 288.40 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | 4-methyl-N-nitro-N-trimethylsilylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N([N+](=O)[O-])[Si](C)(C)C)cc1 |
| InChI | InChI=1S/C10H16N2O4SSi/c1-9-5-7-10(8-6-9)17(15,16)12(11(13)14)18(2,3)4/h5-8H,1-4H3 |
| InChIKey | OTJIXUXNCAXPKW-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.40 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|