C11H24O3Si — CID 71435618
1,2,2-tri(propan-2-yloxy)ethenylsilane (PubChem CID 71435618) has the molecular formula C11H24O3Si and a molecular weight of 232.40 g/mol. Its IUPAC name is 1,2,2-tri(propan-2-yloxy)ethenylsilane.
| Compound Name | 1,2,2-tri(propan-2-yloxy)ethenylsilane |
|---|---|
| PubChem CID | 71435618 |
| Molecular Formula | C11H24O3Si |
| Molecular Weight | 232.40 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | 1,2,2-tri(propan-2-yloxy)ethenylsilane |
| SMILES | CC(C)OC([SiH3])=C(OC(C)C)OC(C)C |
| InChI | InChI=1S/C11H24O3Si/c1-7(2)12-10(13-8(3)4)11(15)14-9(5)6/h7-9H,1-6,15H3 |
| InChIKey | YLCPDHCWCUMYBI-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.40 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|