C19H36O3 — CID 71444065
propan-2-yl 3,7-dimethyl-9-pentan-3-yloxynon-2-enoate (PubChem CID 71444065) has the molecular formula C19H36O3 and a molecular weight of 312.49 g/mol. Its IUPAC name is propan-2-yl 3,7-dimethyl-9-pentan-3-yloxynon-2-enoate.
| Compound Name | propan-2-yl 3,7-dimethyl-9-pentan-3-yloxynon-2-enoate |
|---|---|
| PubChem CID | 71444065 |
| Molecular Formula | C19H36O3 |
| Molecular Weight | 312.49 g/mol |
| Exact Mass | 312.27 |
| IUPAC Name | propan-2-yl 3,7-dimethyl-9-pentan-3-yloxynon-2-enoate |
| SMILES | CCC(CC)OCCC(C)CCCC(C)=CC(=O)OC(C)C |
| InChI | InChI=1S/C19H36O3/c1-7-18(8-2)21-13-12-16(5)10-9-11-17(6)14-19(20)22-15(3)4/h14-16,18H,7-13H2,1-6H3 |
| InChIKey | FVFHLGFLMMHTFZ-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.49 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|