C4BrClF5O2- — CID 7145731
(3S)-3-bromo-4-chloro-2,2,3,4,4-pentafluorobutanoate (PubChem CID 7145731) has the molecular formula C4BrClF5O2- and a molecular weight of 290.39 g/mol. Its IUPAC name is (3S)-3-bromo-4-chloro-2,2,3,4,4-pentafluorobutanoate.
| Compound Name | (3S)-3-bromo-4-chloro-2,2,3,4,4-pentafluorobutanoate |
|---|---|
| PubChem CID | 7145731 |
| Molecular Formula | C4BrClF5O2- |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 288.87 |
| IUPAC Name | (3S)-3-bromo-4-chloro-2,2,3,4,4-pentafluorobutanoate |
| SMILES | O=C([O-])C(F)(F)[C@](F)(Br)C(F)(F)Cl |
| InChI | InChI=1S/C4HBrClF5O2/c5-3(9,4(6,10)11)2(7,8)1(12)13/h(H,12,13)/p-1/t3-/m1/s1 |
| InChIKey | IFQBWLXWJWDSTE-GSVOUGTGSA-M |
| XLogP | 1.26 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|