C29H34N4O3S — CID 71498324
(2S)-2-amino-6-[[amino-(3-tritylsulfanylpropanoylamino)methylidene]amino]hexanoic acid (PubChem CID 71498324) has the molecular formula C29H34N4O3S and a molecular weight of 518.68 g/mol. Its IUPAC name is (2S)-2-amino-6-[[amino-(3-tritylsulfanylpropanoylamino)methylidene]amino]hexanoic acid.
| Compound Name | (2S)-2-amino-6-[[amino-(3-tritylsulfanylpropanoylamino)methylidene]amino]hexanoic acid |
|---|---|
| PubChem CID | 71498324 |
| Molecular Formula | C29H34N4O3S |
| Molecular Weight | 518.68 g/mol |
| Exact Mass | 518.24 |
| IUPAC Name | (2S)-2-amino-6-[[amino-(3-tritylsulfanylpropanoylamino)methylidene]amino]hexanoic acid |
| SMILES | N/C(=N\CCCC[C@H](N)C(=O)O)NC(=O)CCSC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H34N4O3S/c30-25(27(35)36)18-10-11-20-32-28(31)33-26(34)19-21-37-29(22-12-4-1-5-13-22,23-14-6-2-7-15-23)24-16-8-3-9-17-24/h1-9,12-17,25H,10-11,18-21,30H2,(H,35,36)(H3,31,32,33,34)/t25-/m0/s1 |
| InChIKey | GFGNHDRFJIFWPG-VWLOTQADSA-N |
| XLogP | 4.11 |
| TPSA | 130.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.68 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|