C14H23N2O3+ — CID 71532263
9-(2,3-dimethylimidazol-3-ium-1-yl)-4-oxononanoic acid (PubChem CID 71532263) has the molecular formula C14H23N2O3+ and a molecular weight of 267.35 g/mol. Its IUPAC name is 9-(2,3-dimethylimidazol-3-ium-1-yl)-4-oxononanoic acid.
| Compound Name | 9-(2,3-dimethylimidazol-3-ium-1-yl)-4-oxononanoic acid |
|---|---|
| PubChem CID | 71532263 |
| Molecular Formula | C14H23N2O3+ |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | 9-(2,3-dimethylimidazol-3-ium-1-yl)-4-oxononanoic acid |
| SMILES | Cc1n(CCCCCC(=O)CCC(=O)O)cc[n+]1C |
| InChI | InChI=1S/C14H22N2O3/c1-12-15(2)10-11-16(12)9-5-3-4-6-13(17)7-8-14(18)19/h10-11H,3-9H2,1-2H3/p+1 |
| InChIKey | CSZNJRYYTFIQBP-UHFFFAOYSA-O |
| XLogP | 1.62 |
| TPSA | 63.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|