9-(2,3-dimethylimidazol-3-ium-1-yl)-4-oxononanoic acid

C14H23N2O3+ — CID 71532263

IUPAC9-(2,3-dimethylimidazol-3-ium-1-yl)-4-oxononanoic acid
SMILESCc1n(CCCCCC(=O)CCC(=O)O)cc[n+]1C
InChIInChI=1S/C14H22N2O3/c1-12-15(2)10-11-16(12)9-5-3-4-6-13(17)7-8-14(18)19/h10-11H,3-9H2,1-2H3/p+1
InChIKeyCSZNJRYYTFIQBP-UHFFFAOYSA-O
MW267.35 g/mol
LogP1.62
Rot. Bonds9

About 9-(2,3-dimethylimidazol-3-ium-1-yl)-4-oxononanoic acid

9-(2,3-dimethylimidazol-3-ium-1-yl)-4-oxononanoic acid (PubChem CID 71532263) has the molecular formula C14H23N2O3+ and a molecular weight of 267.35 g/mol. Its IUPAC name is 9-(2,3-dimethylimidazol-3-ium-1-yl)-4-oxononanoic acid.

Molecular Properties

Compound Name9-(2,3-dimethylimidazol-3-ium-1-yl)-4-oxononanoic acid
PubChem CID71532263
Molecular FormulaC14H23N2O3+
Molecular Weight267.35 g/mol
Exact Mass267.17
IUPAC Name9-(2,3-dimethylimidazol-3-ium-1-yl)-4-oxononanoic acid
SMILESCc1n(CCCCCC(=O)CCC(=O)O)cc[n+]1C
InChIInChI=1S/C14H22N2O3/c1-12-15(2)10-11-16(12)9-5-3-4-6-13(17)7-8-14(18)19/h10-11H,3-9H2,1-2H3/p+1
InChIKeyCSZNJRYYTFIQBP-UHFFFAOYSA-O
XLogP1.62
TPSA63.18 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds9
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500267.35
LogP ≤ 51.62
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}

Analyze 9-(2,3-dimethylimidazol-3-ium-1-yl)-4-oxononanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 9-(2,3-dimethylimidazol-3-ium-1-yl)-4-oxononanoic acid?
The IUPAC name of 9-(2,3-dimethylimidazol-3-ium-1-yl)-4-oxononanoic acid (CID 71532263) is 9-(2,3-dimethylimidazol-3-ium-1-yl)-4-oxononanoic acid.
What is the SMILES notation for 9-(2,3-dimethylimidazol-3-ium-1-yl)-4-oxononanoic acid?
The canonical SMILES for 9-(2,3-dimethylimidazol-3-ium-1-yl)-4-oxononanoic acid is Cc1n(CCCCCC(=O)CCC(=O)O)cc[n+]1C.
What is the InChIKey of 9-(2,3-dimethylimidazol-3-ium-1-yl)-4-oxononanoic acid?
The InChIKey is CSZNJRYYTFIQBP-UHFFFAOYSA-O. The full InChI is InChI=1S/C14H22N2O3/c1-12-15(2)10-11-16(12)9-5-3-4-6-13(17)7-8-14(18)19/h10-11H,3-9H2,1-2H3/p+1.
What are the key properties of 9-(2,3-dimethylimidazol-3-ium-1-yl)-4-oxononanoic acid?
9-(2,3-dimethylimidazol-3-ium-1-yl)-4-oxononanoic acid has a molecular weight of 267.35 g/mol, XLogP of 1.62, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(2,3-dimethylimidazol-3-ium-1-yl)-4-oxononanoic acid is sourced from PubChem (CID 71532263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).