C36H44O4Si — CID 71545713
(2R,3S,3aS,7aS)-3a-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-2-methoxy-3-(phenoxymethyl)-2,3,7,7a-tetrahydro-1H-inden-4-one (PubChem CID 71545713) has the molecular formula C36H44O4Si and a molecular weight of 568.83 g/mol. Its IUPAC name is (2R,3S,3aS,7aS)-3a-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-2-methoxy-3-(phenoxymethyl)-2,3,7,7a-tetrahydro-1H-inden-4-one.
| Compound Name | (2R,3S,3aS,7aS)-3a-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-2-methoxy-3-(phenoxymethyl)-2,3,7,7a-tetrahydro-1H-inden-4-one |
|---|---|
| PubChem CID | 71545713 |
| Molecular Formula | C36H44O4Si |
| Molecular Weight | 568.83 g/mol |
| Exact Mass | 568.30 |
| IUPAC Name | (2R,3S,3aS,7aS)-3a-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-2-methoxy-3-(phenoxymethyl)-2,3,7,7a-tetrahydro-1H-inden-4-one |
| SMILES | CO[C@@H]1C[C@@H]2CC=CC(=O)[C@]2(CCCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@H]1COc1ccccc1 |
| InChI | InChI=1S/C36H44O4Si/c1-35(2,3)41(30-19-10-6-11-20-30,31-21-12-7-13-22-31)40-25-15-24-36-28(16-14-23-34(36)37)26-33(38-4)32(36)27-39-29-17-8-5-9-18-29/h5-14,17-23,28,32-33H,15-16,24-27H2,1-4H3/t28-,32-,33+,36-/m0/s1 |
| InChIKey | NOBGXCHUIGRLJT-NZXVFTGISA-N |
| XLogP | 6.59 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.83 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|