C41H67NO2Si2 — CID 75068459
3-[3-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-6-methyl-4-tri(propan-2-yl)silyloxy-1,4,5,6,7,7a-hexahydroinden-3a-yl]propan-1-amine (PubChem CID 75068459) has the molecular formula C41H67NO2Si2 and a molecular weight of 662.16 g/mol. Its IUPAC name is 3-[3-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-6-methyl-4-tri(propan-2-yl)silyloxy-1,4,5,6,7,7a-hexahydroinden-3a-yl]propan-1-amine.
| Compound Name | 3-[3-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-6-methyl-4-tri(propan-2-yl)silyloxy-1,4,5,6,7,7a-hexahydroinden-3a-yl]propan-1-amine |
|---|---|
| PubChem CID | 75068459 |
| Molecular Formula | C41H67NO2Si2 |
| Molecular Weight | 662.16 g/mol |
| Exact Mass | 661.47 |
| IUPAC Name | 3-[3-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-6-methyl-4-tri(propan-2-yl)silyloxy-1,4,5,6,7,7a-hexahydroinden-3a-yl]propan-1-amine |
| SMILES | CC1CC2CC=C(CCCO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)C2(CCCN)C(O[Si](C(C)C)(C(C)C)C(C)C)C1 |
| InChI | InChI=1S/C41H67NO2Si2/c1-31(2)45(32(3)4,33(5)6)44-39-30-34(7)29-36-25-24-35(41(36,39)26-18-27-42)19-17-28-43-46(40(8,9)10,37-20-13-11-14-21-37)38-22-15-12-16-23-38/h11-16,20-24,31-34,36,39H,17-19,25-30,42H2,1-10H3 |
| InChIKey | KCQPUARAHHDOPM-UHFFFAOYSA-N |
| XLogP | 10.01 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.16 |
| LogP ≤ 5 | 10.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|