C41H62O6Si — CID 72701100
(6R)-6-[(4R,5R)-5-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-1-[(4S,6S)-2,2-dimethyl-6-pent-4-enyl-1,3-dioxan-4-yl]heptan-3-one (PubChem CID 72701100) has the molecular formula C41H62O6Si and a molecular weight of 679.03 g/mol. Its IUPAC name is (6R)-6-[(4R,5R)-5-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-1-[(4S,6S)-2,2-dimethyl-6-pent-4-enyl-1,3-dioxan-4-yl]heptan-3-one.
| Compound Name | (6R)-6-[(4R,5R)-5-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-1-[(4S,6S)-2,2-dimethyl-6-pent-4-enyl-1,3-dioxan-4-yl]heptan-3-one |
|---|---|
| PubChem CID | 72701100 |
| Molecular Formula | C41H62O6Si |
| Molecular Weight | 679.03 g/mol |
| Exact Mass | 678.43 |
| IUPAC Name | (6R)-6-[(4R,5R)-5-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-1-[(4S,6S)-2,2-dimethyl-6-pent-4-enyl-1,3-dioxan-4-yl]heptan-3-one |
| SMILES | C=CCCC[C@H]1C[C@H](CCC(=O)CC[C@@H](C)[C@H]2OC(C)(C)O[C@@H]2CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)OC(C)(C)O1 |
| InChI | InChI=1S/C41H62O6Si/c1-10-11-14-19-33-30-34(45-40(6,7)44-33)27-26-32(42)25-24-31(2)38-37(46-41(8,9)47-38)28-29-43-48(39(3,4)5,35-20-15-12-16-21-35)36-22-17-13-18-23-36/h10,12-13,15-18,20-23,31,33-34,37-38H,1,11,14,19,24-30H2,2-9H3/t31-,33+,34+,37-,38-/m1/s1 |
| InChIKey | NLSRQUIWVLMFRO-NJTFJNAVSA-N |
| XLogP | 8.51 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.03 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|