C32H39F2O7P — CID 72712838
(2S,3R,4R,5S,6S)-2-[diethoxyphosphoryl(difluoro)methyl]-6-methyl-3,4,5-tris(phenylmethoxy)oxane (PubChem CID 72712838) has the molecular formula C32H39F2O7P and a molecular weight of 604.63 g/mol. Its IUPAC name is (2S,3R,4R,5S,6S)-2-[diethoxyphosphoryl(difluoro)methyl]-6-methyl-3,4,5-tris(phenylmethoxy)oxane.
| Compound Name | (2S,3R,4R,5S,6S)-2-[diethoxyphosphoryl(difluoro)methyl]-6-methyl-3,4,5-tris(phenylmethoxy)oxane |
|---|---|
| PubChem CID | 72712838 |
| Molecular Formula | C32H39F2O7P |
| Molecular Weight | 604.63 g/mol |
| Exact Mass | 604.24 |
| IUPAC Name | (2S,3R,4R,5S,6S)-2-[diethoxyphosphoryl(difluoro)methyl]-6-methyl-3,4,5-tris(phenylmethoxy)oxane |
| SMILES | CCOP(=O)(OCC)C(F)(F)[C@H]1O[C@@H](C)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C32H39F2O7P/c1-4-39-42(35,40-5-2)32(33,34)31-30(38-23-27-19-13-8-14-20-27)29(37-22-26-17-11-7-12-18-26)28(24(3)41-31)36-21-25-15-9-6-10-16-25/h6-20,24,28-31H,4-5,21-23H2,1-3H3/t24-,28-,29+,30+,31-/m0/s1 |
| InChIKey | SGOOJGDCQCRCHG-RQKAHOPCSA-N |
| XLogP | 7.39 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.63 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|