C18H19ClF3NO4 — CID 76854252
[1-(2,2,2-trifluoroethyl)piperidin-4-yl]methyl 3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoate (PubChem CID 76854252) has the molecular formula C18H19ClF3NO4 and a molecular weight of 405.80 g/mol. Its IUPAC name is [1-(2,2,2-trifluoroethyl)piperidin-4-yl]methyl 3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoate.
| Compound Name | [1-(2,2,2-trifluoroethyl)piperidin-4-yl]methyl 3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoate |
|---|---|
| PubChem CID | 76854252 |
| Molecular Formula | C18H19ClF3NO4 |
| Molecular Weight | 405.80 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | [1-(2,2,2-trifluoroethyl)piperidin-4-yl]methyl 3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoate |
| SMILES | O=C(C=Cc1cc(Cl)c2c(c1)OCO2)OCC1CCN(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C18H19ClF3NO4/c19-14-7-13(8-15-17(14)27-11-26-15)1-2-16(24)25-9-12-3-5-23(6-4-12)10-18(20,21)22/h1-2,7-8,12H,3-6,9-11H2 |
| InChIKey | KWYYBJKEMRJLAO-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.80 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|