C7H12F2OSi — CID 78060537
6-[(Difluoromethyl)silyl]hexan-2-one (PubChem CID 78060537) has the molecular formula C7H12F2OSi and a molecular weight of 178.25 g/mol.
| Compound Name | 6-[(Difluoromethyl)silyl]hexan-2-one |
|---|---|
| PubChem CID | 78060537 |
| Molecular Formula | C7H12F2OSi |
| Molecular Weight | 178.25 g/mol |
| Exact Mass | 178.06 |
| IUPAC Name | — |
| SMILES | CC(=O)CCCC[Si]C(F)F |
| InChI | InChI=1S/C7H12F2OSi/c1-6(10)4-2-3-5-11-7(8)9/h7H,2-5H2,1H3 |
| InChIKey | OANIFVIOPFXCHK-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.25 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|