C18H14O5S2 — CID 8018599
methyl 5-[[(Z)-2,3-dithiophen-2-ylprop-2-enoyl]oxymethyl]furan-2-carboxylate (PubChem CID 8018599) has the molecular formula C18H14O5S2 and a molecular weight of 374.44 g/mol. Its IUPAC name is methyl 5-[[(Z)-2,3-dithiophen-2-ylprop-2-enoyl]oxymethyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[(Z)-2,3-dithiophen-2-ylprop-2-enoyl]oxymethyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 8018599 |
| Molecular Formula | C18H14O5S2 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.03 |
| IUPAC Name | methyl 5-[[(Z)-2,3-dithiophen-2-ylprop-2-enoyl]oxymethyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(COC(=O)/C(=C/c2cccs2)c2cccs2)o1 |
| InChI | InChI=1S/C18H14O5S2/c1-21-18(20)15-7-6-12(23-15)11-22-17(19)14(16-5-3-9-25-16)10-13-4-2-8-24-13/h2-10H,11H2,1H3/b14-10+ |
| InChIKey | KLFNRQIZOPNZMW-GXDHUFHOSA-N |
| XLogP | 4.47 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|