C7H9N5OS2 — CID 80614789
3-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methyl]-4-methyl-1,3-thiazol-2-one (PubChem CID 80614789) has the molecular formula C7H9N5OS2 and a molecular weight of 243.32 g/mol. Its IUPAC name is 3-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methyl]-4-methyl-1,3-thiazol-2-one.
| Compound Name | 3-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methyl]-4-methyl-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 80614789 |
| Molecular Formula | C7H9N5OS2 |
| Molecular Weight | 243.32 g/mol |
| Exact Mass | 243.02 |
| IUPAC Name | 3-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methyl]-4-methyl-1,3-thiazol-2-one |
| SMILES | Cc1csc(=O)n1Cc1nnc(NN)s1 |
| InChI | InChI=1S/C7H9N5OS2/c1-4-3-14-7(13)12(4)2-5-10-11-6(9-8)15-5/h3H,2,8H2,1H3,(H,9,11) |
| InChIKey | CEBLSLYWMXFZEH-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.32 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|