C10H6ClN3 — CID 82396781
1-chloro-5H-pyridazino[4,5-b]indole (PubChem CID 82396781) has the molecular formula C10H6ClN3 and a molecular weight of 203.63 g/mol. Its IUPAC name is 1-chloro-5H-pyridazino[4,5-b]indole.
| Compound Name | 1-chloro-5H-pyridazino[4,5-b]indole |
|---|---|
| PubChem CID | 82396781 |
| Molecular Formula | C10H6ClN3 |
| Molecular Weight | 203.63 g/mol |
| Exact Mass | 203.03 |
| IUPAC Name | 1-chloro-5H-pyridazino[4,5-b]indole |
| SMILES | Clc1nncc2[nH]c3ccccc3c12 |
| InChI | InChI=1S/C10H6ClN3/c11-10-9-6-3-1-2-4-7(6)13-8(9)5-12-14-10/h1-5,13H |
| InChIKey | ILBAFPXWULGUCT-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.63 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |