C12H8Cl3N3OS — CID 825486
(4S)-4-phenyl-4-(trichloromethyl)-3H-[1,3]thiazolo[3,2-a][1,3,5]triazin-2-one (PubChem CID 825486) has the molecular formula C12H8Cl3N3OS and a molecular weight of 348.64 g/mol. Its IUPAC name is (4S)-4-phenyl-4-(trichloromethyl)-3H-[1,3]thiazolo[3,2-a][1,3,5]triazin-2-one.
| Compound Name | (4S)-4-phenyl-4-(trichloromethyl)-3H-[1,3]thiazolo[3,2-a][1,3,5]triazin-2-one |
|---|---|
| PubChem CID | 825486 |
| Molecular Formula | C12H8Cl3N3OS |
| Molecular Weight | 348.64 g/mol |
| Exact Mass | 346.95 |
| IUPAC Name | (4S)-4-phenyl-4-(trichloromethyl)-3H-[1,3]thiazolo[3,2-a][1,3,5]triazin-2-one |
| SMILES | O=C1N=C2SC=CN2[C@@](c2ccccc2)(C(Cl)(Cl)Cl)N1 |
| InChI | InChI=1S/C12H8Cl3N3OS/c13-12(14,15)11(8-4-2-1-3-5-8)17-9(19)16-10-18(11)6-7-20-10/h1-7H,(H,17,19)/t11-/m0/s1 |
| InChIKey | JAXJIIMLYLCPAI-NSHDSACASA-N |
| XLogP | 3.81 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.64 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|