About CID 86038274
CID 86038274 (PubChem CID 86038274) has the molecular formula C6H13OSi
and a molecular weight of 129.25 g/mol.
Molecular Properties
| Compound Name | CID 86038274 |
| PubChem CID | 86038274 |
| Molecular Formula | C6H13OSi |
| Molecular Weight | 129.25 g/mol |
| Exact Mass | 129.07 |
| IUPAC Name | — |
| SMILES | CC(O)CCCC[Si] |
| InChI | InChI=1S/C6H13OSi/c1-6(7)4-2-3-5-8/h6-7H,2-5H2,1H3 |
| InChIKey | PJLNFXBCBICDGR-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.25 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 86038274 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 86038274?
The IUPAC name of CID 86038274 (CID 86038274) is not available.
What is the SMILES notation for CID 86038274?
The canonical SMILES for CID 86038274 is CC(O)CCCC[Si].
What is the InChIKey of CID 86038274?
The InChIKey is PJLNFXBCBICDGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13OSi/c1-6(7)4-2-3-5-8/h6-7H,2-5H2,1H3.
What are the key properties of CID 86038274?
CID 86038274 has a molecular weight of 129.25 g/mol, XLogP of 1.12, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 86038274 is sourced from PubChem (CID 86038274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).