C10H13NO5S2 — CID 86590239
[(5R)-3-(4-methylthiophen-2-yl)-2-oxo-1,3-oxazolidin-5-yl]methyl methanesulfonate (PubChem CID 86590239) has the molecular formula C10H13NO5S2 and a molecular weight of 291.35 g/mol. Its IUPAC name is [(5R)-3-(4-methylthiophen-2-yl)-2-oxo-1,3-oxazolidin-5-yl]methyl methanesulfonate.
| Compound Name | [(5R)-3-(4-methylthiophen-2-yl)-2-oxo-1,3-oxazolidin-5-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 86590239 |
| Molecular Formula | C10H13NO5S2 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.02 |
| IUPAC Name | [(5R)-3-(4-methylthiophen-2-yl)-2-oxo-1,3-oxazolidin-5-yl]methyl methanesulfonate |
| SMILES | Cc1csc(N2C[C@H](COS(C)(=O)=O)OC2=O)c1 |
| InChI | InChI=1S/C10H13NO5S2/c1-7-3-9(17-6-7)11-4-8(16-10(11)12)5-15-18(2,13)14/h3,6,8H,4-5H2,1-2H3/t8-/m1/s1 |
| InChIKey | CSVWPMOGGCKYHB-MRVPVSSYSA-N |
| XLogP | 1.36 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|