C22H25N3O6 — CID 86605272
3-[[(3S,4R,5R,6S)-5-azido-4-hydroxy-6-[(4-methoxyphenyl)methoxymethyl]oxan-3-yl]methyl]benzoic acid (PubChem CID 86605272) has the molecular formula C22H25N3O6 and a molecular weight of 427.46 g/mol. Its IUPAC name is 3-[[(3S,4R,5R,6S)-5-azido-4-hydroxy-6-[(4-methoxyphenyl)methoxymethyl]oxan-3-yl]methyl]benzoic acid.
| Compound Name | 3-[[(3S,4R,5R,6S)-5-azido-4-hydroxy-6-[(4-methoxyphenyl)methoxymethyl]oxan-3-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 86605272 |
| Molecular Formula | C22H25N3O6 |
| Molecular Weight | 427.46 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | 3-[[(3S,4R,5R,6S)-5-azido-4-hydroxy-6-[(4-methoxyphenyl)methoxymethyl]oxan-3-yl]methyl]benzoic acid |
| SMILES | COc1ccc(COC[C@H]2OC[C@H](Cc3cccc(C(=O)O)c3)[C@@H](O)[C@H]2N=[N+]=[N-])cc1 |
| InChI | InChI=1S/C22H25N3O6/c1-29-18-7-5-14(6-8-18)11-30-13-19-20(24-25-23)21(26)17(12-31-19)10-15-3-2-4-16(9-15)22(27)28/h2-9,17,19-21,26H,10-13H2,1H3,(H,27,28)/t17-,19+,20-,21+/m0/s1 |
| InChIKey | XWPLJKLTPGTSIL-FYZZASKESA-N |
| XLogP | 3.21 |
| TPSA | 133.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.46 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|