C25H30F3N3O5Si — CID 86612403
3,4-difluoro-2-[2-fluoro-4-(2-trimethylsilylethynyl)anilino]-N-(2-hydroxyethoxy)-5-[(Z)-(2-hydroxy-2-methylpropoxy)iminomethyl]benzamide (PubChem CID 86612403) has the molecular formula C25H30F3N3O5Si and a molecular weight of 537.61 g/mol. Its IUPAC name is 3,4-difluoro-2-[2-fluoro-4-(2-trimethylsilylethynyl)anilino]-N-(2-hydroxyethoxy)-5-[(Z)-(2-hydroxy-2-methylpropoxy)iminomethyl]benzamide.
| Compound Name | 3,4-difluoro-2-[2-fluoro-4-(2-trimethylsilylethynyl)anilino]-N-(2-hydroxyethoxy)-5-[(Z)-(2-hydroxy-2-methylpropoxy)iminomethyl]benzamide |
|---|---|
| PubChem CID | 86612403 |
| Molecular Formula | C25H30F3N3O5Si |
| Molecular Weight | 537.61 g/mol |
| Exact Mass | 537.19 |
| IUPAC Name | 3,4-difluoro-2-[2-fluoro-4-(2-trimethylsilylethynyl)anilino]-N-(2-hydroxyethoxy)-5-[(Z)-(2-hydroxy-2-methylpropoxy)iminomethyl]benzamide |
| SMILES | CC(C)(O)CO/N=C\c1cc(C(=O)NOCCO)c(Nc2ccc(C#C[Si](C)(C)C)cc2F)c(F)c1F |
| InChI | InChI=1S/C25H30F3N3O5Si/c1-25(2,34)15-36-29-14-17-13-18(24(33)31-35-10-9-32)23(22(28)21(17)27)30-20-7-6-16(12-19(20)26)8-11-37(3,4)5/h6-7,12-14,30,32,34H,9-10,15H2,1-5H3,(H,31,33)/b29-14- |
| InChIKey | ZIRKDTAOYQPIIP-NUJZUDFISA-N |
| XLogP | 3.85 |
| TPSA | 112.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.61 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|