C25H26N6O2 — CID 87083548
(3aR,6aR)-N-[4-(3-ethynylanilino)-7-methoxyquinazolin-6-yl]-N-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrole-5-carboxamide (PubChem CID 87083548) has the molecular formula C25H26N6O2 and a molecular weight of 442.52 g/mol. Its IUPAC name is (3aR,6aR)-N-[4-(3-ethynylanilino)-7-methoxyquinazolin-6-yl]-N-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrole-5-carboxamide.
| Compound Name | (3aR,6aR)-N-[4-(3-ethynylanilino)-7-methoxyquinazolin-6-yl]-N-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 87083548 |
| Molecular Formula | C25H26N6O2 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | (3aR,6aR)-N-[4-(3-ethynylanilino)-7-methoxyquinazolin-6-yl]-N-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrole-5-carboxamide |
| SMILES | C#Cc1cccc(Nc2ncnc3cc(OC)c(N(C)C(=O)N4C[C@H]5CCN[C@H]5C4)cc23)c1 |
| InChI | InChI=1S/C25H26N6O2/c1-4-16-6-5-7-18(10-16)29-24-19-11-22(23(33-3)12-20(19)27-15-28-24)30(2)25(32)31-13-17-8-9-26-21(17)14-31/h1,5-7,10-12,15,17,21,26H,8-9,13-14H2,2-3H3,(H,27,28,29)/t17-,21+/m1/s1 |
| InChIKey | GBDULAIJKPRAPS-UTKZUKDTSA-N |
| XLogP | 3.21 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|