C12H24BNO6 — CID 87465705
diacetyloxyboranyl acetate;N,N-diethylethanamine (PubChem CID 87465705) has the molecular formula C12H24BNO6 and a molecular weight of 289.14 g/mol. Its IUPAC name is diacetyloxyboranyl acetate;N,N-diethylethanamine.
| Compound Name | diacetyloxyboranyl acetate;N,N-diethylethanamine |
|---|---|
| PubChem CID | 87465705 |
| Molecular Formula | C12H24BNO6 |
| Molecular Weight | 289.14 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | diacetyloxyboranyl acetate;N,N-diethylethanamine |
| SMILES | CC(=O)OB(OC(C)=O)OC(C)=O.CCN(CC)CC |
| InChI | InChI=1S/C6H9BO6.C6H15N/c1-4(8)11-7(12-5(2)9)13-6(3)10;1-4-7(5-2)6-3/h1-3H3;4-6H2,1-3H3 |
| InChIKey | GBDVWCOZJOFPNE-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.14 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|