About 3-[4-(dimethylamino)phenyl]-N-phenylprop-2-en-1-imine oxide;hydrochloride
3-[4-(dimethylamino)phenyl]-N-phenylprop-2-en-1-imine oxide;hydrochloride (PubChem CID 87519765) has the molecular formula C17H19ClN2O
and a molecular weight of 302.81 g/mol. Its IUPAC name is 3-[4-(dimethylamino)phenyl]-N-phenylprop-2-en-1-imine oxide;hydrochloride.
Molecular Properties
| Compound Name | 3-[4-(dimethylamino)phenyl]-N-phenylprop-2-en-1-imine oxide;hydrochloride |
| PubChem CID | 87519765 |
| Molecular Formula | C17H19ClN2O |
| Molecular Weight | 302.81 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | 3-[4-(dimethylamino)phenyl]-N-phenylprop-2-en-1-imine oxide;hydrochloride |
| SMILES | CN(C)c1ccc(C=CC=[N+]([O-])c2ccccc2)cc1.Cl |
| InChI | InChI=1S/C17H18N2O.ClH/c1-18(2)16-12-10-15(11-13-16)7-6-14-19(20)17-8-4-3-5-9-17;/h3-14H,1-2H3;1H |
| InChIKey | ZGFZRWCPNBAKHC-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 29.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.81 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 3-[4-(dimethylamino)phenyl]-N-phenylprop-2-en-1-imine oxide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(dimethylamino)phenyl]-N-phenylprop-2-en-1-imine oxide;hydrochloride?
The IUPAC name of 3-[4-(dimethylamino)phenyl]-N-phenylprop-2-en-1-imine oxide;hydrochloride (CID 87519765) is 3-[4-(dimethylamino)phenyl]-N-phenylprop-2-en-1-imine oxide;hydrochloride.
What is the SMILES notation for 3-[4-(dimethylamino)phenyl]-N-phenylprop-2-en-1-imine oxide;hydrochloride?
The canonical SMILES for 3-[4-(dimethylamino)phenyl]-N-phenylprop-2-en-1-imine oxide;hydrochloride is CN(C)c1ccc(C=CC=[N+]([O-])c2ccccc2)cc1.Cl.
What is the InChIKey of 3-[4-(dimethylamino)phenyl]-N-phenylprop-2-en-1-imine oxide;hydrochloride?
The InChIKey is ZGFZRWCPNBAKHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18N2O.ClH/c1-18(2)16-12-10-15(11-13-16)7-6-14-19(20)17-8-4-3-5-9-17;/h3-14H,1-2H3;1H.
What are the key properties of 3-[4-(dimethylamino)phenyl]-N-phenylprop-2-en-1-imine oxide;hydrochloride?
3-[4-(dimethylamino)phenyl]-N-phenylprop-2-en-1-imine oxide;hydrochloride has a molecular weight of 302.81 g/mol, XLogP of 4.10, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(dimethylamino)phenyl]-N-phenylprop-2-en-1-imine oxide;hydrochloride is sourced from PubChem (CID 87519765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).