C23H25Cl2N5O3 — CID 87561369
2-[4-[1-chloro-2-(4-chlorophenyl)ethyl]-3,6-dioxo-1-prop-2-ynylpiperazin-2-yl]-N-(3-imidazol-1-ylpropyl)acetamide (PubChem CID 87561369) has the molecular formula C23H25Cl2N5O3 and a molecular weight of 490.39 g/mol. Its IUPAC name is 2-[4-[1-chloro-2-(4-chlorophenyl)ethyl]-3,6-dioxo-1-prop-2-ynylpiperazin-2-yl]-N-(3-imidazol-1-ylpropyl)acetamide.
| Compound Name | 2-[4-[1-chloro-2-(4-chlorophenyl)ethyl]-3,6-dioxo-1-prop-2-ynylpiperazin-2-yl]-N-(3-imidazol-1-ylpropyl)acetamide |
|---|---|
| PubChem CID | 87561369 |
| Molecular Formula | C23H25Cl2N5O3 |
| Molecular Weight | 490.39 g/mol |
| Exact Mass | 489.13 |
| IUPAC Name | 2-[4-[1-chloro-2-(4-chlorophenyl)ethyl]-3,6-dioxo-1-prop-2-ynylpiperazin-2-yl]-N-(3-imidazol-1-ylpropyl)acetamide |
| SMILES | C#CCN1C(=O)CN(C(Cl)Cc2ccc(Cl)cc2)C(=O)C1CC(=O)NCCCn1ccnc1 |
| InChI | InChI=1S/C23H25Cl2N5O3/c1-2-10-29-19(14-21(31)27-8-3-11-28-12-9-26-16-28)23(33)30(15-22(29)32)20(25)13-17-4-6-18(24)7-5-17/h1,4-7,9,12,16,19-20H,3,8,10-11,13-15H2,(H,27,31) |
| InChIKey | XDRRRUBQRVNPID-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 87.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.39 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|