C22H23IN4O6S3 — CID 87692460
3-[11-[3-(1,3-dimethyl-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)prop-1-enyl]-10-(2-iodoacetyl)-9-thia-2,10-diazatricyclo[4.3.2.03,8]undeca-3(8),4,6-trien-2-yl]propane-1-sulfonic acid (PubChem CID 87692460) has the molecular formula C22H23IN4O6S3 and a molecular weight of 662.55 g/mol. Its IUPAC name is 3-[11-[3-(1,3-dimethyl-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)prop-1-enyl]-10-(2-iodoacetyl)-9-thia-2,10-diazatricyclo[4.3.2.03,8]undeca-3(8),4,6-trien-2-yl]propane-1-sulfonic acid.
| Compound Name | 3-[11-[3-(1,3-dimethyl-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)prop-1-enyl]-10-(2-iodoacetyl)-9-thia-2,10-diazatricyclo[4.3.2.03,8]undeca-3(8),4,6-trien-2-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 87692460 |
| Molecular Formula | C22H23IN4O6S3 |
| Molecular Weight | 662.55 g/mol |
| Exact Mass | 661.98 |
| IUPAC Name | 3-[11-[3-(1,3-dimethyl-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)prop-1-enyl]-10-(2-iodoacetyl)-9-thia-2,10-diazatricyclo[4.3.2.03,8]undeca-3(8),4,6-trien-2-yl]propane-1-sulfonic acid |
| SMILES | CN1C(=O)C(=CC=CC2c3ccc4c(c3)SC(N4CCCS(=O)(=O)O)N2C(=O)CI)C(=O)N(C)C1=S |
| InChI | InChI=1S/C22H23IN4O6S3/c1-24-19(29)14(20(30)25(2)21(24)34)5-3-6-15-13-7-8-16-17(11-13)35-22(27(15)18(28)12-23)26(16)9-4-10-36(31,32)33/h3,5-8,11,15,22H,4,9-10,12H2,1-2H3,(H,31,32,33) |
| InChIKey | FDPQVTWLXRJQAY-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 118.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.55 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|