C12H23N4O12P — CID 87696484
(2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;2-phosphonooxypropane-1,2,3-tricarboxylic acid (PubChem CID 87696484) has the molecular formula C12H23N4O12P and a molecular weight of 446.31 g/mol. Its IUPAC name is (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;2-phosphonooxypropane-1,2,3-tricarboxylic acid.
| Compound Name | (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;2-phosphonooxypropane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 87696484 |
| Molecular Formula | C12H23N4O12P |
| Molecular Weight | 446.31 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;2-phosphonooxypropane-1,2,3-tricarboxylic acid |
| SMILES | NC(N)=NCCC[C@H](N)C(=O)O.O=C(O)CC(CC(=O)O)(OP(=O)(O)O)C(=O)O |
| InChI | InChI=1S/C6H14N4O2.C6H9O10P/c7-4(5(11)12)2-1-3-10-6(8)9;7-3(8)1-6(5(11)12,2-4(9)10)16-17(13,14)15/h4H,1-3,7H2,(H,11,12)(H4,8,9,10);1-2H2,(H,7,8)(H,9,10)(H,11,12)(H2,13,14,15)/t4-;/m0./s1 |
| InChIKey | CGDKOMIGPIPLTF-WCCKRBBISA-N |
| XLogP | -2.68 |
| TPSA | 306.38 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.31 |
| LogP ≤ 5 | -2.68 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|