C5HF10OP — CID 87925353
1,2,2,3,3,4,4,5,5,6-decafluoro-1λ5-phosphinane 1-oxide (PubChem CID 87925353) has the molecular formula C5HF10OP and a molecular weight of 298.02 g/mol. Its IUPAC name is 1,2,2,3,3,4,4,5,5,6-decafluoro-1λ5-phosphinane 1-oxide.
| Compound Name | 1,2,2,3,3,4,4,5,5,6-decafluoro-1λ5-phosphinane 1-oxide |
|---|---|
| PubChem CID | 87925353 |
| Molecular Formula | C5HF10OP |
| Molecular Weight | 298.02 g/mol |
| Exact Mass | 297.96 |
| IUPAC Name | 1,2,2,3,3,4,4,5,5,6-decafluoro-1λ5-phosphinane 1-oxide |
| SMILES | O=P1(F)C(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C5HF10OP/c6-1-2(7,8)3(9,10)4(11,12)5(13,14)17(1,15)16/h1H |
| InChIKey | QNKLMYDBSUBMDC-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.02 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|