C27H28F7N3O5 — CID 87979352
[[(3aR,6S,7aR)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-[[3-fluoro-5-(trifluoromethyl)phenyl]carbamoyl]amino] 2,2,2-trifluoroacetate (PubChem CID 87979352) has the molecular formula C27H28F7N3O5 and a molecular weight of 607.52 g/mol. Its IUPAC name is [[(3aR,6S,7aR)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-[[3-fluoro-5-(trifluoromethyl)phenyl]carbamoyl]amino] 2,2,2-trifluoroacetate.
| Compound Name | [[(3aR,6S,7aR)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-[[3-fluoro-5-(trifluoromethyl)phenyl]carbamoyl]amino] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 87979352 |
| Molecular Formula | C27H28F7N3O5 |
| Molecular Weight | 607.52 g/mol |
| Exact Mass | 607.19 |
| IUPAC Name | [[(3aR,6S,7aR)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-[[3-fluoro-5-(trifluoromethyl)phenyl]carbamoyl]amino] 2,2,2-trifluoroacetate |
| SMILES | COc1ccc([C@]23CC[C@H](N(OC(=O)C(F)(F)F)C(=O)Nc4cc(F)cc(C(F)(F)F)c4)C[C@H]2N(C)CC3)cc1OC |
| InChI | InChI=1S/C27H28F7N3O5/c1-36-9-8-25(15-4-5-20(40-2)21(12-15)41-3)7-6-19(14-22(25)36)37(42-23(38)27(32,33)34)24(39)35-18-11-16(26(29,30)31)10-17(28)13-18/h4-5,10-13,19,22H,6-9,14H2,1-3H3,(H,35,39)/t19-,22+,25+/m0/s1 |
| InChIKey | ZGGFVFRAFNCHPG-UWUFEASWSA-N |
| XLogP | 5.91 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.52 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|