C14H20N2O8S2 — CID 88701068
2-amino-3-[[(2R)-2-[bis(prop-2-enoxycarbonyl)amino]-2-carboxyethyl]disulfanyl]propanoic acid (PubChem CID 88701068) has the molecular formula C14H20N2O8S2 and a molecular weight of 408.45 g/mol. Its IUPAC name is 2-amino-3-[[(2R)-2-[bis(prop-2-enoxycarbonyl)amino]-2-carboxyethyl]disulfanyl]propanoic acid.
| Compound Name | 2-amino-3-[[(2R)-2-[bis(prop-2-enoxycarbonyl)amino]-2-carboxyethyl]disulfanyl]propanoic acid |
|---|---|
| PubChem CID | 88701068 |
| Molecular Formula | C14H20N2O8S2 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.07 |
| IUPAC Name | 2-amino-3-[[(2R)-2-[bis(prop-2-enoxycarbonyl)amino]-2-carboxyethyl]disulfanyl]propanoic acid |
| SMILES | C=CCOC(=O)N(C(=O)OCC=C)[C@@H](CSSCC(N)C(=O)O)C(=O)O |
| InChI | InChI=1S/C14H20N2O8S2/c1-3-5-23-13(21)16(14(22)24-6-4-2)10(12(19)20)8-26-25-7-9(15)11(17)18/h3-4,9-10H,1-2,5-8,15H2,(H,17,18)(H,19,20)/t9?,10-/m0/s1 |
| InChIKey | IBJSEBOEKOVZPZ-AXDSSHIGSA-N |
| XLogP | 1.18 |
| TPSA | 156.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|