C28H36ClN9S2 — CID 88789026
2-[(E)-3-[4-(benzylamino)phenyl]prop-2-enyl]-1-cyano-3-[3-[[2-[(N'-ethylcarbamimidoyl)amino]-1,3-thiazol-4-yl]methylsulfanyl]propyl]guanidine;hydrochloride (PubChem CID 88789026) has the molecular formula C28H36ClN9S2 and a molecular weight of 598.25 g/mol. Its IUPAC name is 2-[(E)-3-[4-(benzylamino)phenyl]prop-2-enyl]-1-cyano-3-[3-[[2-[(N'-ethylcarbamimidoyl)amino]-1,3-thiazol-4-yl]methylsulfanyl]propyl]guanidine;hydrochloride.
| Compound Name | 2-[(E)-3-[4-(benzylamino)phenyl]prop-2-enyl]-1-cyano-3-[3-[[2-[(N'-ethylcarbamimidoyl)amino]-1,3-thiazol-4-yl]methylsulfanyl]propyl]guanidine;hydrochloride |
|---|---|
| PubChem CID | 88789026 |
| Molecular Formula | C28H36ClN9S2 |
| Molecular Weight | 598.25 g/mol |
| Exact Mass | 597.22 |
| IUPAC Name | 2-[(E)-3-[4-(benzylamino)phenyl]prop-2-enyl]-1-cyano-3-[3-[[2-[(N'-ethylcarbamimidoyl)amino]-1,3-thiazol-4-yl]methylsulfanyl]propyl]guanidine;hydrochloride |
| SMILES | CC/N=C(\N)Nc1nc(CSCCCN/C(=N/C/C=C/c2ccc(NCc3ccccc3)cc2)NC#N)cs1.Cl |
| InChI | InChI=1S/C28H35N9S2.ClH/c1-2-31-26(30)37-28-36-25(20-39-28)19-38-17-7-16-33-27(35-21-29)32-15-6-10-22-11-13-24(14-12-22)34-18-23-8-4-3-5-9-23;/h3-6,8-14,20,34H,2,7,15-19H2,1H3,(H2,32,33,35)(H3,30,31,36,37);1H/b10-6+; |
| InChIKey | LJACISDBBNDNFY-AAGWESIMSA-N |
| XLogP | 5.28 |
| TPSA | 135.54 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.25 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|