About 2-(tert-butyldiazenyl)heptan-2-ol;heptan-2-one
2-(tert-butyldiazenyl)heptan-2-ol;heptan-2-one (PubChem CID 88847025) has the molecular formula C18H38N2O2
and a molecular weight of 314.51 g/mol. Its IUPAC name is 2-(tert-butyldiazenyl)heptan-2-ol;heptan-2-one.
Molecular Properties
| Compound Name | 2-(tert-butyldiazenyl)heptan-2-ol;heptan-2-one |
| PubChem CID | 88847025 |
| Molecular Formula | C18H38N2O2 |
| Molecular Weight | 314.51 g/mol |
| Exact Mass | 314.29 |
| IUPAC Name | 2-(tert-butyldiazenyl)heptan-2-ol;heptan-2-one |
| SMILES | CCCCCC(C)(O)/N=N/C(C)(C)C.CCCCCC(C)=O |
| InChI | InChI=1S/C11H24N2O.C7H14O/c1-6-7-8-9-11(5,14)13-12-10(2,3)4;1-3-4-5-6-7(2)8/h14H,6-9H2,1-5H3;3-6H2,1-2H3/b13-12+; |
| InChIKey | NYASNJGGWJZXPA-UEIGIMKUSA-N |
| XLogP | 5.68 |
| TPSA | 62.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 314.51 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(tert-butyldiazenyl)heptan-2-ol;heptan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(tert-butyldiazenyl)heptan-2-ol;heptan-2-one?
The IUPAC name of 2-(tert-butyldiazenyl)heptan-2-ol;heptan-2-one (CID 88847025) is 2-(tert-butyldiazenyl)heptan-2-ol;heptan-2-one.
What is the SMILES notation for 2-(tert-butyldiazenyl)heptan-2-ol;heptan-2-one?
The canonical SMILES for 2-(tert-butyldiazenyl)heptan-2-ol;heptan-2-one is CCCCCC(C)(O)/N=N/C(C)(C)C.CCCCCC(C)=O.
What is the InChIKey of 2-(tert-butyldiazenyl)heptan-2-ol;heptan-2-one?
The InChIKey is NYASNJGGWJZXPA-UEIGIMKUSA-N. The full InChI is InChI=1S/C11H24N2O.C7H14O/c1-6-7-8-9-11(5,14)13-12-10(2,3)4;1-3-4-5-6-7(2)8/h14H,6-9H2,1-5H3;3-6H2,1-2H3/b13-12+;.
What are the key properties of 2-(tert-butyldiazenyl)heptan-2-ol;heptan-2-one?
2-(tert-butyldiazenyl)heptan-2-ol;heptan-2-one has a molecular weight of 314.51 g/mol, XLogP of 5.68, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(tert-butyldiazenyl)heptan-2-ol;heptan-2-one is sourced from PubChem (CID 88847025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).