C26H21F3N6OS — CID 88851447
1-(2-cyclopropylphenyl)-1-[(E)-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]thiourea (PubChem CID 88851447) has the molecular formula C26H21F3N6OS and a molecular weight of 522.56 g/mol. Its IUPAC name is 1-(2-cyclopropylphenyl)-1-[(E)-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]thiourea.
| Compound Name | 1-(2-cyclopropylphenyl)-1-[(E)-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 88851447 |
| Molecular Formula | C26H21F3N6OS |
| Molecular Weight | 522.56 g/mol |
| Exact Mass | 522.14 |
| IUPAC Name | 1-(2-cyclopropylphenyl)-1-[(E)-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]thiourea |
| SMILES | NC(=S)N(/N=C/c1ccc(-c2ncn(-c3ccc(OC(F)(F)F)cc3)n2)cc1)c1ccccc1C1CC1 |
| InChI | InChI=1S/C26H21F3N6OS/c27-26(28,29)36-21-13-11-20(12-14-21)34-16-31-24(33-34)19-7-5-17(6-8-19)15-32-35(25(30)37)23-4-2-1-3-22(23)18-9-10-18/h1-8,11-16,18H,9-10H2,(H2,30,37)/b32-15+ |
| InChIKey | PYXMEZDDUAJZSV-VWJSQJICSA-N |
| XLogP | 5.79 |
| TPSA | 81.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.56 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|