C21H20ClN7O2S — CID 89210623
N-[4-(chloroamino)phenyl]-4-(6,7-dihydroxy-9H-pyrimido[4,5-b]indol-4-yl)piperazine-1-carbothioamide (PubChem CID 89210623) has the molecular formula C21H20ClN7O2S and a molecular weight of 469.96 g/mol. Its IUPAC name is N-[4-(chloroamino)phenyl]-4-(6,7-dihydroxy-9H-pyrimido[4,5-b]indol-4-yl)piperazine-1-carbothioamide.
| Compound Name | N-[4-(chloroamino)phenyl]-4-(6,7-dihydroxy-9H-pyrimido[4,5-b]indol-4-yl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 89210623 |
| Molecular Formula | C21H20ClN7O2S |
| Molecular Weight | 469.96 g/mol |
| Exact Mass | 469.11 |
| IUPAC Name | N-[4-(chloroamino)phenyl]-4-(6,7-dihydroxy-9H-pyrimido[4,5-b]indol-4-yl)piperazine-1-carbothioamide |
| SMILES | Oc1cc2[nH]c3ncnc(N4CCN(C(=S)Nc5ccc(NCl)cc5)CC4)c3c2cc1O |
| InChI | InChI=1S/C21H20ClN7O2S/c22-27-13-3-1-12(2-4-13)25-21(32)29-7-5-28(6-8-29)20-18-14-9-16(30)17(31)10-15(14)26-19(18)23-11-24-20/h1-4,9-11,27,30-31H,5-8H2,(H,25,32)(H,23,24,26) |
| InChIKey | IHZFCERHAUVRHY-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.96 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|