C7H5ClF2Mg — CID 89350621
magnesium;1,3-difluoro-5-methanidylbenzene;chloride (PubChem CID 89350621) has the molecular formula C7H5ClF2Mg and a molecular weight of 186.87 g/mol. Its IUPAC name is magnesium;1,3-difluoro-5-methanidylbenzene;chloride.
| Compound Name | magnesium;1,3-difluoro-5-methanidylbenzene;chloride |
|---|---|
| PubChem CID | 89350621 |
| Molecular Formula | C7H5ClF2Mg |
| Molecular Weight | 186.87 g/mol |
| Exact Mass | 185.99 |
| IUPAC Name | magnesium;1,3-difluoro-5-methanidylbenzene;chloride |
| SMILES | [CH2-]c1cc(F)cc(F)c1.[Cl-].[Mg+2] |
| InChI | InChI=1S/C7H5F2.ClH.Mg/c1-5-2-6(8)4-7(9)3-5;;/h2-4H,1H2;1H;/q-1;;+2/p-1 |
| InChIKey | XKCHLEFZYRHECB-UHFFFAOYSA-M |
| XLogP | -1.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.87 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|